cas: 39106-10-0 — see every product listed under this CAS number, including other names
2-Chloro-N-(2,4-dimethylphenyl)acetamide, 95%, 95% (CAS 39106-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9XZ-100mg |
| cas | 39106-10-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 962.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-(2,4-dimethylphenyl)acetamide (CAS 39106-10-0) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-N-(2,4-dimethylphenyl)acetamide. InChIKey: MZTGUDQVUJJYCK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dimethylphenyl)acetamide |
| InChIKey | MZTGUDQVUJJYCK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CCl)C |
Computed by PubChem (NCBI)