cas: 177172-49-5 — see every product listed under this CAS number, including other names
2-Chloro-N-[(1R)-1-(3-methoxyphenyl)ethyl]benzenepropanamine hydrochloride, 98+%, 98+% (CAS 177172-49-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113663-25mg |
| cas | 177172-49-5 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 472.40 Pln | |
| Chemat | 50mg | 731.60 Pln | |
| Chemat | 100mg | 1192.40 Pln | |
| Chemat | 250mg | 2334.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride (CAS 177172-49-5) is a chemical compound with the molecular formula C18H23Cl2NO and a molecular weight of 340.3 g/mol. IUPAC name: 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride. InChIKey: YJXUXANREVNZLH-PFEQFJNWSA-N.
| Molecular formula | C18H23Cl2NO |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride |
| InChIKey | YJXUXANREVNZLH-PFEQFJNWSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OC)NCCCC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)