CAS 177172-49-5 appears in our catalog under these names: R 568 hydrochloride, R 568 Hydrochloride, 95%, Tecalcet Hydrochloride/ 99.44% (existing batch purity), Tecalcet Hydrochloride, Tecalcet HCl 98+%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 100mg, 250mg, 2mg, 10mg, 25mg, 50mg, 1mg.
3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride (CAS 177172-49-5) is a chemical compound with the molecular formula C18H23Cl2NO and a molecular weight of 340.3 g/mol. IUPAC name: 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride. InChIKey: YJXUXANREVNZLH-PFEQFJNWSA-N.
| Molecular formula | C18H23Cl2NO |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine;hydrochloride |
| InChIKey | YJXUXANREVNZLH-PFEQFJNWSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OC)NCCCC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)