cas: 7497-52-1 — see every product listed under this CAS number, including other names
2-Chloroacridin-9(10H)-one 98% (CAS 7497-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205854-100mg |
| cas | 7497-52-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2011.31 Pln | |
| Ambeed | 5g | 6016.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205854 |
2-chloro-10H-acridin-9-one (CAS 7497-52-1) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: 2-chloro-10H-acridin-9-one. InChIKey: WNLFUMVKGWEXBI-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2-chloro-10H-acridin-9-one |
| InChIKey | WNLFUMVKGWEXBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)