CAS 1261958-08-0 is the registry number for 4-(4-Chloro-3-cyanophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-5-(4-hydroxyphenyl)benzonitrile (CAS 1261958-08-0) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: 2-chloro-5-(4-hydroxyphenyl)benzonitrile. InChIKey: PKQRGNDFSFBAKO-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2-chloro-5-(4-hydroxyphenyl)benzonitrile |
| InChIKey | PKQRGNDFSFBAKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)Cl)C#N)O |
Computed by PubChem (NCBI)