cas: 5906-98-9 — see every product listed under this CAS number, including other names
2-Chlorobenzenesulfonohydrazide (CAS 5906-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F452278-100MG |
| cas | 5906-98-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 5g | 2174.25 Pln |
| delivery time | 3-4 weeks |
|---|
2-chlorobenzenesulfonohydrazide (CAS 5906-98-9) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 2-chlorobenzenesulfonohydrazide. InChIKey: JXYCJRIKOCVGAF-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 2-chlorobenzenesulfonohydrazide |
| InChIKey | JXYCJRIKOCVGAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)NN)Cl |
Computed by PubChem (NCBI)