Products 2055119-06-5
CAS 2055119-06-5 is the registry number for 5-Chloro-3-methanesulfonylpyridin-2-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-3-methylsulfonylpyridin-2-amine (CAS 2055119-06-5) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 5-chloro-3-methylsulfonylpyridin-2-amine. InChIKey: RGRJJLUKVCVTGX-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 5-chloro-3-methylsulfonylpyridin-2-amine |
| InChIKey | RGRJJLUKVCVTGX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=CC(=C1)Cl)N |
Computed by PubChem (NCBI)