cas: 71501-29-6 — see every product listed under this CAS number, including other names
2-Chlorobenzo(d)thiazol-4-ol, 95% (CAS 71501-29-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A351546-5g |
| cas | 71501-29-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16097.62 Pln | |
| AmBeed | 1g | 6755.77 Pln | |
| AmBeed | 10g | 26787.04 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-1,3-benzothiazol-4-ol (CAS 71501-29-6) is a chemical compound with the molecular formula C7H4ClNOS and a molecular weight of 185.63 g/mol. IUPAC name: 2-chloro-1,3-benzothiazol-4-ol. InChIKey: SVGBAVVCBYGVCS-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNOS |
|---|---|
| Molecular weight | 185.63 g/mol |
| IUPAC name | 2-chloro-1,3-benzothiazol-4-ol |
| InChIKey | SVGBAVVCBYGVCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)Cl)O |
Computed by PubChem (NCBI)