CAS 51793-93-2 appears in our catalog under these names: 7-Chloro-1,3-benzoxazole-2-thiol, 95%, 7-chloro-1,3-benzoxazole-2-thiol, 98%, 7-Chlorobenzo[d]oxazole-2-thiol, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
7-chloro-3H-1,3-benzoxazole-2-thione (CAS 51793-93-2) is a chemical compound with the molecular formula C7H4ClNOS and a molecular weight of 185.63 g/mol. IUPAC name: 7-chloro-3H-1,3-benzoxazole-2-thione. InChIKey: XXRDNTGJMQMSLW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNOS |
|---|---|
| Molecular weight | 185.63 g/mol |
| IUPAC name | 7-chloro-3H-1,3-benzoxazole-2-thione |
| InChIKey | XXRDNTGJMQMSLW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=S)N2 |
Computed by PubChem (NCBI)