cas: 28442-78-6 — see every product listed under this CAS number, including other names
2-Chloroisophthalonitrile 98% (CAS 28442-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A197984-100mg |
| cas | 28442-78-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1215.88 Pln | |
| Ambeed | 5g | 3641.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A197984 |
2-chlorobenzene-1,3-dicarbonitrile (CAS 28442-78-6) is a chemical compound with the molecular formula C8H3ClN2 and a molecular weight of 162.57 g/mol. IUPAC name: 2-chlorobenzene-1,3-dicarbonitrile. InChIKey: KELQMIQLTBTJNV-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2 |
|---|---|
| Molecular weight | 162.57 g/mol |
| IUPAC name | 2-chlorobenzene-1,3-dicarbonitrile |
| InChIKey | KELQMIQLTBTJNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)Cl)C#N |
Computed by PubChem (NCBI)