2-Chloropyridine-4-sulfonamide, 97%
cas: 1182767-38-9 — see every product listed under this CAS number, including other names
2-Chloropyridine-4-sulfonamide, 97% (CAS 1182767-38-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A816034-250mg |
| cas | 1182767-38-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1599.69 Pln | |
| Ambeed | 1g | 3702.31 Pln | |
| Ambeed | 5g | 12769.19 Pln | |
| BLDpharm | 100mg | 864.16 Pln | |
| BLDpharm | 250mg | 1397.31 Pln | |
| BLDpharm | 1g | 3985.29 Pln | |
| BLDpharm | 5g | 13765.18 Pln | |
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 962.00 Pln | |
| Chemat | 1g | 2488.40 Pln | |
| Chemat | 5g | 8550.80 Pln | |
| Fluorochem | 100mg | 1008.00 Pln | |
| Fluorochem | 250mg | 1653.60 Pln | |
| Fluorochem | 1g | 3767.44 Pln | |
| Fluorochem | 5g | 12816.34 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloropyridine-4-sulfonamide (CAS 1182767-38-9) is a chemical compound with the molecular formula C5H5ClN2O2S and a molecular weight of 192.62 g/mol. IUPAC name: 2-chloropyridine-4-sulfonamide. InChIKey: HMULZMJXHFXUDR-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O2S |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 2-chloropyridine-4-sulfonamide |
| InChIKey | HMULZMJXHFXUDR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)