CAS 7145-62-2 appears in our catalog under these names: 3-Chloro-6-(methylsulfonyl)pyridazine, 95%, 3-Chloro-6-(methylsulfonyl)pyridazine 95%, 3-Chloro-6-(methylsulfonyl)pyridazine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-chloro-6-methylsulfonylpyridazine (CAS 7145-62-2) is a chemical compound with the molecular formula C5H5ClN2O2S and a molecular weight of 192.62 g/mol. IUPAC name: 3-chloro-6-methylsulfonylpyridazine. InChIKey: BUHGCLPAHGFCLE-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O2S |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 3-chloro-6-methylsulfonylpyridazine |
| InChIKey | BUHGCLPAHGFCLE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(C=C1)Cl |
Computed by PubChem (NCBI)