cas: 128676-84-6 — see every product listed under this CAS number, including other names
2-Chloroquinoline-3-boronic acid 96% (CAS 128676-84-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A609099-5g |
| cas | 128676-84-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 548.38 Pln | |
| Ambeed | 25g | 1249.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A609099 |
(2-chloroquinolin-3-yl)boronic acid (CAS 128676-84-6) is a chemical compound with the molecular formula C9H7BClNO2 and a molecular weight of 207.42 g/mol. IUPAC name: (2-chloroquinolin-3-yl)boronic acid. InChIKey: JAQXYUOPSOXQCG-UHFFFAOYSA-N.
| Molecular formula | C9H7BClNO2 |
|---|---|
| Molecular weight | 207.42 g/mol |
| IUPAC name | (2-chloroquinolin-3-yl)boronic acid |
| InChIKey | JAQXYUOPSOXQCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1Cl)(O)O |
Computed by PubChem (NCBI)