CAS 128676-84-6 appears in our catalog under these names: 2-Chloroquinoline-3-boronic acid, 96%, 2-Chloroquinoline-3-boronic acid 96%, 2-Chloroquinoline-3-boronic acid, 95%, 95%, 2-Chloroquinoline-3-boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 100mg, 250mg.
(2-chloroquinolin-3-yl)boronic acid (CAS 128676-84-6) is a chemical compound with the molecular formula C9H7BClNO2 and a molecular weight of 207.42 g/mol. IUPAC name: (2-chloroquinolin-3-yl)boronic acid. InChIKey: JAQXYUOPSOXQCG-UHFFFAOYSA-N.
| Molecular formula | C9H7BClNO2 |
|---|---|
| Molecular weight | 207.42 g/mol |
| IUPAC name | (2-chloroquinolin-3-yl)boronic acid |
| InChIKey | JAQXYUOPSOXQCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1Cl)(O)O |
Computed by PubChem (NCBI)