cas: 31255-57-9 — see every product listed under this CAS number, including other names
2-Cyano-3-(3-chlorophenylethyl)pyridine, 97% (CAS 31255-57-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494224-25G |
| cas | 31255-57-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 924.69 Pln | |
| Fluorochem | 500g | 3168.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile (CAS 31255-57-9) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile. InChIKey: JPCGKKFEDUHGDF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile |
| InChIKey | JPCGKKFEDUHGDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCC2=C(N=CC=C2)C#N |
Computed by PubChem (NCBI)