cas: 80194-70-3 — see every product listed under this CAS number, including other names
2-Cyano-3-chloro-5-trifluoromethylpyridine, 95% (CAS 80194-70-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033058-1G |
| cas | 80194-70-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 1075.68 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-5-(trifluoromethyl)pyridine-2-carbonitrile (CAS 80194-70-3) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: FUPKVFJSGNZICR-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | FUPKVFJSGNZICR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C#N)C(F)(F)F |
Computed by PubChem (NCBI)