CAS 1807217-26-0 is the registry number for 4-Chloro-6-(trifluoromethyl)pyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 1807217-26-0) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: NAIFZQCXPOLWKI-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | NAIFZQCXPOLWKI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)C#N)Cl |
Computed by PubChem (NCBI)