cas: 24973-49-7 — see every product listed under this CAS number, including other names
2-Cyanobiphenyl 98% (CAS 24973-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A814931-250mg |
| cas | 24973-49-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A814931 |
2-phenylbenzonitrile (CAS 24973-49-7) is a chemical compound with the molecular formula C13H9N and a molecular weight of 179.22 g/mol. IUPAC name: 2-phenylbenzonitrile. InChIKey: WLPATYNQCGVFFH-UHFFFAOYSA-N.
| Molecular formula | C13H9N |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-phenylbenzonitrile |
| InChIKey | WLPATYNQCGVFFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)