CAS 24973-49-7 appears in our catalog under these names: 2-Phenylbenzonitrile, 98%, 2-Cyanobiphenyl, [1,1'-Biphenyl]-2-carbonitrile, >98.0%(GC), 2-Cyanobiphenyl 98%, 2-Cyanobiphenyl, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 2,5g, 200mg, 250mg, 10g, 25g.
2-phenylbenzonitrile (CAS 24973-49-7) is a chemical compound with the molecular formula C13H9N and a molecular weight of 179.22 g/mol. IUPAC name: 2-phenylbenzonitrile. InChIKey: WLPATYNQCGVFFH-UHFFFAOYSA-N.
| Molecular formula | C13H9N |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-phenylbenzonitrile |
| InChIKey | WLPATYNQCGVFFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)