cas: 3601-89-6 — see every product listed under this CAS number, including other names
2-Deoxy-3,5-di-O-p-toluoyl-D-erythro-pentofuranosyl chloride, 98% (CAS 3601-89-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F787648-5G |
| cas | 3601-89-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 544.62 Pln | |
| Fluorochem | 100g | 1815.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 3601-89-6) is a chemical compound with the molecular formula C21H21ClO5 and a molecular weight of 388.8 g/mol. IUPAC name: [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: FJHSYOMVMMNQJQ-PAMZHZACSA-N.
| Molecular formula | C21H21ClO5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | FJHSYOMVMMNQJQ-PAMZHZACSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](CC(O2)Cl)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)