CAS 20535-28-8 is the registry number for 2-Deoxy-D-erythro-pentopyranosyl Chloride Bis(4-methylbenzoate)(Decitabine Impurity)(Mixture of alpha/beta isomers). Offered by: TRC. Available pack sizes: 10g.
[(2S,4S,5R)-2-chloro-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate (CAS 20535-28-8) is a chemical compound with the molecular formula C21H21ClO5 and a molecular weight of 388.8 g/mol. IUPAC name: [(2S,4S,5R)-2-chloro-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate. InChIKey: CPONBGAIBORBPF-IPMKNSEASA-N.
| Molecular formula | C21H21ClO5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | [(2S,4S,5R)-2-chloro-5-(4-methylbenzoyl)oxyoxan-4-yl] 4-methylbenzoate |
| InChIKey | CPONBGAIBORBPF-IPMKNSEASA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2C[C@@H](OC[C@H]2OC(=O)C3=CC=C(C=C3)C)Cl |
Computed by PubChem (NCBI)