cas: 873306-31-1 — see every product listed under this CAS number, including other names
2-Dimethylamino-N-[4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenyl]-acetamide, 95%, 95% (CAS 873306-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11S4SP-250mg |
| cas | 873306-31-1 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 1g | 1701.20 Pln | |
| Chemat | 100mg | 578.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(dimethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 873306-31-1) is a chemical compound with the molecular formula C16H25BN2O3 and a molecular weight of 304.2 g/mol. IUPAC name: 2-(dimethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: DXRMSWHCXHJTIP-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-(dimethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | DXRMSWHCXHJTIP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)CN(C)C |
Computed by PubChem (NCBI)