CAS 1218790-03-4 appears in our catalog under these names: 5-(t-Butylcarbamoyl)pyridine-3-boronic acid, pinacol ester, 96%, 5-(t-Butylcarbamoyl)pyridine-3-boronic acid, pinacol ester, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (CAS 1218790-03-4) is a chemical compound with the molecular formula C16H25BN2O3 and a molecular weight of 304.2 g/mol. IUPAC name: N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide. InChIKey: POBNCDYVYRUCQZ-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| InChIKey | POBNCDYVYRUCQZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)