cas: 1216091-64-3 — see every product listed under this CAS number, including other names
2-Ethoxy-3,5-dimethylbenzoic acid, ≥95%, ≥95% (CAS 1216091-64-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E75O-1g |
| cas | 1216091-64-3 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2166.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-ethoxy-3,5-dimethylbenzoic acid (CAS 1216091-64-3) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-ethoxy-3,5-dimethylbenzoic acid. InChIKey: JKUIFTNWFPHFAX-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-ethoxy-3,5-dimethylbenzoic acid |
| InChIKey | JKUIFTNWFPHFAX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1C(=O)O)C)C |
Computed by PubChem (NCBI)