cas: 28987-44-2 — see every product listed under this CAS number, including other names
2-Ethoxy-4-fluoro-1-nitrobenzene 98% (CAS 28987-44-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323395-5g |
| cas | 28987-44-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A323395 |
2-ethoxy-4-fluoro-1-nitrobenzene (CAS 28987-44-2) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-ethoxy-4-fluoro-1-nitrobenzene. InChIKey: LEMJFSSYFHTFFP-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-ethoxy-4-fluoro-1-nitrobenzene |
| InChIKey | LEMJFSSYFHTFFP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)