cas: 5444-75-7 — see every product listed under this CAS number, including other names
2-Ethylhexyl benzoate, 98% (CAS 5444-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329965-1G |
| cas | 5444-75-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 310.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-ethylhexyl benzoate (CAS 5444-75-7) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2-ethylhexyl benzoate. InChIKey: UADWUILHKRXHMM-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2-ethylhexyl benzoate |
| InChIKey | UADWUILHKRXHMM-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)