cas: 30084-90-3 — see every product listed under this CAS number, including other names
2-Fluorenecarboxaldehyde, >95.0%(T) (CAS 30084-90-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0333-5G |
| cas | 30084-90-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 555.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
9H-fluorene-2-carbaldehyde (CAS 30084-90-3) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 9H-fluorene-2-carbaldehyde. InChIKey: MNQGEQSXFDKAPY-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 9H-fluorene-2-carbaldehyde |
| InChIKey | MNQGEQSXFDKAPY-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)C=O |
Computed by PubChem (NCBI)