cas: 360771-05-7 — see every product listed under this CAS number, including other names
2-Fluoro-(1,1'-biphenyl)-4-amine, 97% (CAS 360771-05-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A262688-5g |
| cas | 360771-05-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21566.02 Pln | |
| AmBeed | 1g | 6078.73 Pln | |
| AmBeed | 10g | 36630.16 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-4-phenylaniline (CAS 360771-05-7) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 3-fluoro-4-phenylaniline. InChIKey: VCHBPECPEWKVHH-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 3-fluoro-4-phenylaniline |
| InChIKey | VCHBPECPEWKVHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)