cas: 360771-05-7 — see every product listed under this CAS number, including other names
3-Fluoro-4-phenylaniline (CAS 360771-05-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632023-1G |
| cas | 360771-05-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4387.01 Pln | |
| Fluorochem | 5g | 13040.22 Pln |
| delivery time | 3-4 weeks |
|---|
3-fluoro-4-phenylaniline (CAS 360771-05-7) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 3-fluoro-4-phenylaniline. InChIKey: VCHBPECPEWKVHH-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 3-fluoro-4-phenylaniline |
| InChIKey | VCHBPECPEWKVHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)