2-Fluoro-10-methyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid 5-oxide, 95%
cas: 2995297-73-7 — see every product listed under this CAS number, including other names
2-Fluoro-10-methyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid 5-oxide, 95% (CAS 2995297-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2250887-250mg |
| cas | 2995297-73-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 5298.75 Pln | |
| Ambeed | 1g | 14682.69 Pln | |
| BLDpharm | 10mg | 903.04 Pln | |
| BLDpharm | 25mg | 1164.06 Pln | |
| BLDpharm | 50mg | 1869.37 Pln | |
| BLDpharm | 100mg | 3074.50 Pln | |
| BLDpharm | 250mg | 5195.97 Pln | |
| BLDpharm | 1g | 14392.73 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
8-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid (CAS 2995297-73-7) is a chemical compound with the molecular formula C15H10FNO4S and a molecular weight of 319.3 g/mol. IUPAC name: 8-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid. InChIKey: DXNPVWPABYPDGY-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO4S |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 8-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid |
| InChIKey | DXNPVWPABYPDGY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)O)S(=O)C3=C(C1=O)C=C(C=C3)F |
Computed by PubChem (NCBI)