cas: 1352719-37-9 — see every product listed under this CAS number, including other names
2-Fluoro-3-methoxy-4-(trifluoromethyl)benzaldehyde (CAS 1352719-37-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628456-1G |
| cas | 1352719-37-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6370.69 Pln | |
| Fluorochem | 5g | 18970.42 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-3-methoxy-4-(trifluoromethyl)benzaldehyde (CAS 1352719-37-9) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-fluoro-3-methoxy-4-(trifluoromethyl)benzaldehyde. InChIKey: KPNLJRNFRLJHBW-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-4-(trifluoromethyl)benzaldehyde |
| InChIKey | KPNLJRNFRLJHBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)