CAS 195447-79-1 appears in our catalog under these names: 3-Fluoro-5-(trifluoromethyl)phenylacetic acid, 98%, 3-Fluoro-5-(trifluoromethyl)phenylacetic Acid, 3-Fluoro-5-(trifluoromethyl)benzeneacetic acid, 98%, 98%, 3-Fluoro-5-(trifluoromethyl)phenylacetic acid, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100g.
2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid (CAS 195447-79-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: LQIBHDUPSIQRPV-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | LQIBHDUPSIQRPV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CC(=O)O |
Computed by PubChem (NCBI)