cas: 871126-17-9 — see every product listed under this CAS number, including other names
2-Fluoro-3-methoxy-6-bromophenylboronic acid, 98%, 98% (CAS 871126-17-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119FF8-25g |
| cas | 871126-17-9 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 424.40 Pln | |
| Chemat | 5g | 189.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6-bromo-2-fluoro-3-methoxyphenyl)boronic acid (CAS 871126-17-9) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (6-bromo-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: NUWSIUDCKHWOJN-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | NUWSIUDCKHWOJN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)Br)(O)O |
Computed by PubChem (NCBI)