CAS 943830-77-1 is the registry number for 4-Bromo-2-fluoro-3-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
(4-bromo-2-fluoro-3-methoxyphenyl)boronic acid (CAS 943830-77-1) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (4-bromo-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: LNJCQONZYKAVJA-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (4-bromo-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | LNJCQONZYKAVJA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)OC)F)(O)O |
Computed by PubChem (NCBI)