Products 943830-77-1

CAS 943830-77-1 appears in our catalog under these names: 4-Bromo-2-fluoro-3-methoxyphenylboronic acid, 98%, 4-Bromo-2-fluoro-3-methoxyphenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

(4-bromo-2-fluoro-3-methoxyphenyl)boronic acid (CAS 943830-77-1) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (4-bromo-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: LNJCQONZYKAVJA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BBrFO3
Molecular weight248.84 g/mol
IUPAC name(4-bromo-2-fluoro-3-methoxyphenyl)boronic acid
InChIKeyLNJCQONZYKAVJA-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)Br)OC)F)(O)O

Computed by PubChem (NCBI)