cas: 897016-97-6 — see every product listed under this CAS number, including other names
2-Fluoro-4-(morpholinomethyl)phenylboronic acid pinacol ester, 97%, 97% (CAS 897016-97-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1153PK-100mg |
| cas | 897016-97-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 376.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 897016-97-6) is a chemical compound with the molecular formula C17H25BFNO3 and a molecular weight of 321.2 g/mol. IUPAC name: 4-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: DWJRSQOUYHDWKV-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO3 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 4-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | DWJRSQOUYHDWKV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CN3CCOCC3)F |
Computed by PubChem (NCBI)