CAS 2377610-63-2 is the registry number for 4-Fluoro-3-(morpholinomethyl)phenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 2377610-63-2) is a chemical compound with the molecular formula C17H25BFNO3 and a molecular weight of 321.2 g/mol. IUPAC name: 4-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: MEFYLLKRLMZBPE-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO3 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 4-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | MEFYLLKRLMZBPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CN3CCOCC3 |
Computed by PubChem (NCBI)