2-Fluoro-4-(piperidin-4-yl)phenol hydrochloride, 98%
cas: 2140866-92-6 — see every product listed under this CAS number, including other names
2-Fluoro-4-(piperidin-4-yl)phenol hydrochloride, 98% (CAS 2140866-92-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A410374-250mg |
| cas | 2140866-92-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1933.44 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 680.90 Pln | |
| BLDpharm | 1g | 1897.13 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 1132.95 Pln | |
| Fluorochem | 1g | 3194.73 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-fluoro-4-piperidin-4-ylphenol;hydrochloride (CAS 2140866-92-6) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 2-fluoro-4-piperidin-4-ylphenol;hydrochloride. InChIKey: GNIFGKPMCSEILG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 2-fluoro-4-piperidin-4-ylphenol;hydrochloride |
| InChIKey | GNIFGKPMCSEILG-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=C(C=C2)O)F.Cl |
Computed by PubChem (NCBI)