CAS 1260845-67-7 appears in our catalog under these names: (2R)-2-(5-Fluoro-2-methoxy-phenyl)pyrrolidine hydrochloride, 95%, (R)–2–(5–Fluoro–2–methoxyphenyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine;hydrochloride (CAS 1260845-67-7) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: (2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine;hydrochloride. InChIKey: NIZBGGSNGPJALP-HNCPQSOCSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | (2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | NIZBGGSNGPJALP-HNCPQSOCSA-N |
| SMILES | COC1=C(C=C(C=C1)F)[C@H]2CCCN2.Cl |
Computed by PubChem (NCBI)