2-Fluoro-4-methoxy-5-nitroaniline, 98%
cas: 1569986-91-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-methoxy-5-nitroaniline, 98% (CAS 1569986-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F622084-100MG |
| cas | 1569986-91-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1393.88 Pln | |
| Ambeed | 25g | 4514.44 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 442.09 Pln | |
| BLDpharm | 5g | 1497.28 Pln | |
| BLDpharm | 25g | 4862.76 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1445.34 Pln | |
| Fluorochem | 25g | 4616.10 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-fluoro-4-methoxy-5-nitroaniline (CAS 1569986-91-9) is a chemical compound with the molecular formula C7H7FN2O3 and a molecular weight of 186.14 g/mol. IUPAC name: 2-fluoro-4-methoxy-5-nitroaniline. InChIKey: QNGXAMOUXIMNCN-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O3 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | 2-fluoro-4-methoxy-5-nitroaniline |
| InChIKey | QNGXAMOUXIMNCN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)