Products 2925476-24-8
CAS 2925476-24-8 is the registry number for (R,E)-3-(3-(1-Fluoroethyl)-1,2,4-oxadiazol-5-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[3-[(1R)-1-fluoroethyl]-1,2,4-oxadiazol-5-yl]prop-2-enoic acid (CAS 2925476-24-8) is a chemical compound with the molecular formula C7H7FN2O3 and a molecular weight of 186.14 g/mol. IUPAC name: (E)-3-[3-[(1R)-1-fluoroethyl]-1,2,4-oxadiazol-5-yl]prop-2-enoic acid. InChIKey: LTXMGJRHEGZTPL-FSSWKIGTSA-N.
| Molecular formula | C7H7FN2O3 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | (E)-3-[3-[(1R)-1-fluoroethyl]-1,2,4-oxadiazol-5-yl]prop-2-enoic acid |
| InChIKey | LTXMGJRHEGZTPL-FSSWKIGTSA-N |
| SMILES | C[C@H](C1=NOC(=N1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)