cas: 1363192-17-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1363192-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627766-1G |
| cas | 1363192-17-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2731.35 Pln | |
| Fluorochem | 5g | 8068.01 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1363192-17-9) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OLDKXRDBCREFQC-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OLDKXRDBCREFQC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2C)F |
Computed by PubChem (NCBI)