Products 1228594-52-2

CAS 1228594-52-2 is the registry number for 2-Fluoro-3-(piperidin-1-ylmethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[2-fluoro-3-(piperidin-1-ylmethyl)phenyl]boronic acid (CAS 1228594-52-2) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: [2-fluoro-3-(piperidin-1-ylmethyl)phenyl]boronic acid. InChIKey: PLSPPIOEMADOFR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17BFNO2
Molecular weight237.08 g/mol
IUPAC name[2-fluoro-3-(piperidin-1-ylmethyl)phenyl]boronic acid
InChIKeyPLSPPIOEMADOFR-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)CN2CCCCC2)F)(O)O

Computed by PubChem (NCBI)