cas: 755027-42-0 — see every product listed under this CAS number, including other names
2-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 95+% (CAS 755027-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175190-100mg |
| cas | 755027-42-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 1087.94 Pln | |
| Ambeed | 1g | 2717.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A175190 |
2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 755027-42-0) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: UAPUIZLKGCQCRM-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | UAPUIZLKGCQCRM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2C)F |
Computed by PubChem (NCBI)