cas: 887266-98-0 — see every product listed under this CAS number, including other names
2-Fluoro-6-nitrobenzene-1-sulfonyl chloride 95+% (CAS 887266-98-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193606-100mg |
| cas | 887266-98-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 4469.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193606 |
2-fluoro-6-nitrobenzenesulfonyl chloride (CAS 887266-98-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-6-nitrobenzenesulfonyl chloride. InChIKey: QTNQIGYAUISKNU-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-6-nitrobenzenesulfonyl chloride |
| InChIKey | QTNQIGYAUISKNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)