Products 887266-98-0
CAS 887266-98-0 appears in our catalog under these names: 2-Fluoro-6-nitrobenzene-1-sulfonyl chloride, 95%, 2-Fluoro-6-nitrobenzene-1-sulfonyl chloride 95+%, 2-Fluoro-6-nitrobenzene-1-sulfonyl chloride, 95+%, 95+%, 2-Fluoro-6-nitrobenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-fluoro-6-nitrobenzenesulfonyl chloride (CAS 887266-98-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-6-nitrobenzenesulfonyl chloride. InChIKey: QTNQIGYAUISKNU-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-6-nitrobenzenesulfonyl chloride |
| InChIKey | QTNQIGYAUISKNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)