cas: 923243-98-5 — see every product listed under this CAS number, including other names
2-Fluoro-n-(propan-2-yl)benzene-1-sulfonamide, 98%, 98% (CAS 923243-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135UQQ-100mg |
| cas | 923243-98-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1168.40 Pln | |
| Chemat | 5g | 3578.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-N-propan-2-ylbenzenesulfonamide (CAS 923243-98-5) is a chemical compound with the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. IUPAC name: 2-fluoro-N-propan-2-ylbenzenesulfonamide. InChIKey: MJQUGQKMTYLICQ-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO2S |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-fluoro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | MJQUGQKMTYLICQ-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)