cas: 923243-98-5 — see every product listed under this CAS number, including other names
2-Fluoro-n-(propan-2-yl)benzene-1-sulfonamide, 98% (CAS 923243-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F663496-100MG |
| cas | 923243-98-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 500mg | 976.76 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 2.5g | 1934.75 Pln | |
| Fluorochem | 5g | 2569.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-fluoro-N-propan-2-ylbenzenesulfonamide (CAS 923243-98-5) is a chemical compound with the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. IUPAC name: 2-fluoro-N-propan-2-ylbenzenesulfonamide. InChIKey: MJQUGQKMTYLICQ-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO2S |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-fluoro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | MJQUGQKMTYLICQ-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)