CAS 138468-20-9 is the registry number for N-(4-Fluorobenzyl)-N-methylmethanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide (CAS 138468-20-9) is a chemical compound with the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide. InChIKey: LWXAYFKKIYFDCA-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO2S |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide |
| InChIKey | LWXAYFKKIYFDCA-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)F)S(=O)(=O)C |
Computed by PubChem (NCBI)