cas: 383-50-6 — see every product listed under this CAS number, including other names
2-Fluoroethyl 4-methylbenzenesulfonate 97% (CAS 383-50-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143495-250mg |
| cas | 383-50-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1538.50 Pln | |
| Ambeed | 500g | 5938.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143495 |
2-fluoroethyl 4-methylbenzenesulfonate (CAS 383-50-6) is a chemical compound with the molecular formula C9H11FO3S and a molecular weight of 218.25 g/mol. IUPAC name: 2-fluoroethyl 4-methylbenzenesulfonate. InChIKey: XNRDLSNSMTUXBV-UHFFFAOYSA-N.
| Molecular formula | C9H11FO3S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-fluoroethyl 4-methylbenzenesulfonate |
| InChIKey | XNRDLSNSMTUXBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCF |
Computed by PubChem (NCBI)