cas: 1073354-14-9 — see every product listed under this CAS number, including other names
2-Formylpyridinyl-5-boronic acid pinacol ester, 98%, 98% (CAS 1073354-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WHP-100mg |
| cas | 1073354-14-9 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1178.00 Pln | |
| Chemat | 10g | 1955.60 Pln | |
| Chemat | 25g | 3966.80 Pln | |
| Chemat | 500mg | 290.00 Pln | |
| Chemat | 50g | 5219.60 Pln | |
| Chemat | 100g | 9650.00 Pln | |
| Chemat | 250g | 18515.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbaldehyde (CAS 1073354-14-9) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbaldehyde. InChIKey: FCWAOWVIYGJOPZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbaldehyde |
| InChIKey | FCWAOWVIYGJOPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C=O |
Computed by PubChem (NCBI)